ChemNet > CAS > 69625-13-4 2-[4-(4-nitrofenyl)-1,3-thiazool-2-yl]acetonitril
69625-13-4 2-[4-(4-nitrofenyl)-1,3-thiazool-2-yl]acetonitril
| Naam product |
2-[4-(4-nitrofenyl)-1,3-thiazool-2-yl]acetonitril |
| Synoniemen |
[4-(4-nitrofenyl)-1,3-thiazool-2-yl]acetonitril |
| Engelse naam |
2-[4-(4-nitrophenyl)-1,3-thiazol-2-yl]acetonitrile;[4-(4-nitrophenyl)-1,3-thiazol-2-yl]acetonitrile |
| MF |
C11H7N3O2S |
| Molecuulgewicht |
245.2572 |
| InChI |
InChI=1/C11H7N3O2S/c12-6-5-11-13-10(7-17-11)8-1-3-9(4-2-8)14(15)16/h1-4,7H,5H2 |
| CAS-nummer |
69625-13-4 |
| Moleculaire Structuur |
![69625-13-4 2-[4-(4-nitrofenyl)-1,3-thiazool-2-yl]acetonitril](https://images-a.chemnet.com/suppliers/chembase/124/12490.gif)
|
| Dichtheid |
1.397g/cm3 |
| Smeltpunt |
147℃ |
| Kookpunt |
457.3°C at 760 mmHg |
| Brekingsindex |
1.641 |
| Vlampunt |
230.3°C |
| Dampdruk |
1.51E-08mmHg at 25°C |
| Gevaarsymbolen |
 Xn:Harmful;
|
| Risico-codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Veiligheid Omschrijving |
S36/37:Wear suitable protective clothing and gloves.;
|
|
